C34H36N2O2 — CID 140501402
2-tert-butyl-6-[[2-[2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]phenyl]iminomethyl]phenol (PubChem CID 140501402) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]phenyl]iminomethyl]phenol.
| Compound Name | 2-tert-butyl-6-[[2-[2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 140501402 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 2-tert-butyl-6-[[2-[2-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]phenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cccc(/C=N/c2ccccc2-c2ccccc2/N=C/c2cccc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C34H36N2O2/c1-33(2,3)27-17-11-13-23(31(27)37)21-35-29-19-9-7-15-25(29)26-16-8-10-20-30(26)36-22-24-14-12-18-28(32(24)38)34(4,5)6/h7-22,37-38H,1-6H3/b35-21+,36-22+ |
| InChIKey | VZAJPYKVPIPIAC-JTOYJDTJSA-N |
| XLogP | 8.86 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|