C28H34N3O2+ — CID 139043422
2-tert-butyl-6-[[3-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-yl]iminomethyl]phenol (PubChem CID 139043422) has the molecular formula C28H34N3O2+ and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-tert-butyl-6-[[3-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-yl]iminomethyl]phenol.
| Compound Name | 2-tert-butyl-6-[[3-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139043422 |
| Molecular Formula | C28H34N3O2+ |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-tert-butyl-6-[[3-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-yl]iminomethyl]phenol |
| SMILES | C[n+]1ccc(/N=C\c2cccc(C(C)(C)C)c2O)c(/N=C/c2cccc(C(C)(C)C)c2O)c1 |
| InChI | InChI=1S/C28H33N3O2/c1-27(2,3)21-12-8-10-19(25(21)32)16-29-23-14-15-31(7)18-24(23)30-17-20-11-9-13-22(26(20)33)28(4,5)6/h8-18H,1-7H3,(H,30,33)/p+1 |
| InChIKey | RAHZQWQAAJPMPG-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 69.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|