C59H61N3O3 — CID 136635876
2-[[4-[bis[4-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-(4-methylphenyl)methyl]phenyl]iminomethyl]-6-tert-butylphenol (PubChem CID 136635876) has the molecular formula C59H61N3O3 and a molecular weight of 860.15 g/mol. Its IUPAC name is 2-[[4-[bis[4-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-(4-methylphenyl)methyl]phenyl]iminomethyl]-6-tert-butylphenol.
| Compound Name | 2-[[4-[bis[4-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-(4-methylphenyl)methyl]phenyl]iminomethyl]-6-tert-butylphenol |
|---|---|
| PubChem CID | 136635876 |
| Molecular Formula | C59H61N3O3 |
| Molecular Weight | 860.15 g/mol |
| Exact Mass | 859.47 |
| IUPAC Name | 2-[[4-[bis[4-[(3-tert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-(4-methylphenyl)methyl]phenyl]iminomethyl]-6-tert-butylphenol |
| SMILES | Cc1ccc(C(c2ccc(/N=C/c3cccc(C(C)(C)C)c3O)cc2)(c2ccc(/N=C/c3cccc(C(C)(C)C)c3O)cc2)c2ccc(/N=C/c3cccc(C(C)(C)C)c3O)cc2)cc1 |
| InChI | InChI=1S/C59H61N3O3/c1-39-20-22-43(23-21-39)59(44-24-30-47(31-25-44)60-36-40-14-11-17-50(53(40)63)56(2,3)4,45-26-32-48(33-27-45)61-37-41-15-12-18-51(54(41)64)57(5,6)7)46-28-34-49(35-29-46)62-38-42-16-13-19-52(55(42)65)58(8,9)10/h11-38,63-65H,1-10H3/b60-36+,61-37+,62-38+ |
| InChIKey | QIFVABADJGTMSL-NGCJWVHTSA-N |
| XLogP | 14.64 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.15 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|