C21H27NO2 — CID 137048025
3-[(3,5-ditert-butylphenyl)iminomethyl]benzene-1,2-diol (PubChem CID 137048025) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-[(3,5-ditert-butylphenyl)iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[(3,5-ditert-butylphenyl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 137048025 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-[(3,5-ditert-butylphenyl)iminomethyl]benzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(/N=C/c2cccc(O)c2O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27NO2/c1-20(2,3)15-10-16(21(4,5)6)12-17(11-15)22-13-14-8-7-9-18(23)19(14)24/h7-13,23-24H,1-6H3/b22-13+ |
| InChIKey | BWOUOYNAURKYCQ-LPYMAVHISA-N |
| XLogP | 5.44 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|