C15H16N2O2 — CID 136863722
3-[(2-amino-4,5-dimethylphenyl)iminomethyl]benzene-1,2-diol (PubChem CID 136863722) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[(2-amino-4,5-dimethylphenyl)iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[(2-amino-4,5-dimethylphenyl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136863722 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[(2-amino-4,5-dimethylphenyl)iminomethyl]benzene-1,2-diol |
| SMILES | Cc1cc(N)c(/N=C/c2cccc(O)c2O)cc1C |
| InChI | InChI=1S/C15H16N2O2/c1-9-6-12(16)13(7-10(9)2)17-8-11-4-3-5-14(18)15(11)19/h3-8,18-19H,16H2,1-2H3/b17-8+ |
| InChIKey | FHCKIDLZRFIKAE-CAOOACKPSA-N |
| XLogP | 3.05 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|