C14H12N4O6 — CID 136750024
2-[(2-amino-4,5-dinitrophenyl)iminomethyl]-6-methoxyphenol (PubChem CID 136750024) has the molecular formula C14H12N4O6 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-[(2-amino-4,5-dinitrophenyl)iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[(2-amino-4,5-dinitrophenyl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 136750024 |
| Molecular Formula | C14H12N4O6 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[(2-amino-4,5-dinitrophenyl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2N)c1O |
| InChI | InChI=1S/C14H12N4O6/c1-24-13-4-2-3-8(14(13)19)7-16-10-6-12(18(22)23)11(17(20)21)5-9(10)15/h2-7,19H,15H2,1H3/b16-7+ |
| InChIKey | RXPFIEAKCZOSHH-FRKPEAEDSA-N |
| XLogP | 2.55 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|