C14H14N2O4S — CID 3272383
4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 3272383) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 3272383 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | COc1cccc(/C=N/c2ccc(S(N)(=O)=O)cc2)c1O |
| InChI | InChI=1S/C14H14N2O4S/c1-20-13-4-2-3-10(14(13)17)9-16-11-5-7-12(8-6-11)21(15,18)19/h2-9,17H,1H3,(H2,15,18,19)/b16-9+ |
| InChIKey | SESIDVXPAWEAJJ-CXUHLZMHSA-N |
| XLogP | 1.80 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|