C18H14NNaO9S2 — CID 137207477
sodium 5-hydroxy-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate (PubChem CID 137207477) has the molecular formula C18H14NNaO9S2 and a molecular weight of 475.43 g/mol. Its IUPAC name is sodium 5-hydroxy-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate.
| Compound Name | sodium 5-hydroxy-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 137207477 |
| Molecular Formula | C18H14NNaO9S2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | sodium 5-hydroxy-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
| SMILES | COc1cccc(/C=N/c2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)O)cc(O)c23)c1O.[Na+] |
| InChI | InChI=1S/C18H15NO9S2.Na/c1-28-16-4-2-3-10(18(16)21)9-19-14-7-12(29(22,23)24)5-11-6-13(30(25,26)27)8-15(20)17(11)14;/h2-9,20-21H,1H3,(H,22,23,24)(H,25,26,27);/q;+1/p-1/b19-9+; |
| InChIKey | JMNIHRMCBOTEDQ-MYHMWQFYSA-M |
| XLogP | -0.83 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|