C20H17NO2 — CID 4120706
2-(1,2-dihydroacenaphthylen-5-yliminomethyl)-6-methoxyphenol (PubChem CID 4120706) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-5-yliminomethyl)-6-methoxyphenol.
| Compound Name | 2-(1,2-dihydroacenaphthylen-5-yliminomethyl)-6-methoxyphenol |
|---|---|
| PubChem CID | 4120706 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-5-yliminomethyl)-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2ccc3c4c(cccc24)CC3)c1O |
| InChI | InChI=1S/C20H17NO2/c1-23-18-7-3-5-15(20(18)22)12-21-17-11-10-14-9-8-13-4-2-6-16(17)19(13)14/h2-7,10-12,22H,8-9H2,1H3/b21-12+ |
| InChIKey | YQKNTKDTZREQNN-CIAFOILYSA-N |
| XLogP | 4.40 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|