C14H11Br2NO3 — CID 3465269
3,5-dibromo-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenol (PubChem CID 3465269) has the molecular formula C14H11Br2NO3 and a molecular weight of 401.05 g/mol. Its IUPAC name is 3,5-dibromo-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenol.
| Compound Name | 3,5-dibromo-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 3465269 |
| Molecular Formula | C14H11Br2NO3 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 3,5-dibromo-4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenol |
| SMILES | COc1cccc(/C=N/c2c(Br)cc(O)cc2Br)c1O |
| InChI | InChI=1S/C14H11Br2NO3/c1-20-12-4-2-3-8(14(12)19)7-17-13-10(15)5-9(18)6-11(13)16/h2-7,18-19H,1H3/b17-7+ |
| InChIKey | DPNVTKYNZNBBLD-REZTVBANSA-N |
| XLogP | 4.38 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|