C15H13Br2NO3 — CID 3465274
3,5-dibromo-4-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]phenol (PubChem CID 3465274) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is 3,5-dibromo-4-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]phenol.
| Compound Name | 3,5-dibromo-4-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 3465274 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 3,5-dibromo-4-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]phenol |
| SMILES | CCOc1cccc(/C=N/c2c(Br)cc(O)cc2Br)c1O |
| InChI | InChI=1S/C15H13Br2NO3/c1-2-21-13-5-3-4-9(15(13)20)8-18-14-11(16)6-10(19)7-12(14)17/h3-8,19-20H,2H2,1H3/b18-8+ |
| InChIKey | ONNZVVFFEXQAEG-QGMBQPNBSA-N |
| XLogP | 4.77 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|