C19H23NO4 — CID 135657460
2-[(2,5-diethoxyphenyl)iminomethyl]-6-ethoxyphenol (PubChem CID 135657460) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[(2,5-diethoxyphenyl)iminomethyl]-6-ethoxyphenol.
| Compound Name | 2-[(2,5-diethoxyphenyl)iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 135657460 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[(2,5-diethoxyphenyl)iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1ccc(OCC)c(/N=C/c2cccc(OCC)c2O)c1 |
| InChI | InChI=1S/C19H23NO4/c1-4-22-15-10-11-17(23-5-2)16(12-15)20-13-14-8-7-9-18(19(14)21)24-6-3/h7-13,21H,4-6H2,1-3H3/b20-13+ |
| InChIKey | KIDMQCJUGGOVGB-DEDYPNTBSA-N |
| XLogP | 4.34 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|