C19H21NO2 — CID 135657451
2-ethoxy-6-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)phenol (PubChem CID 135657451) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-ethoxy-6-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)phenol.
| Compound Name | 2-ethoxy-6-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)phenol |
|---|---|
| PubChem CID | 135657451 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-ethoxy-6-(5,6,7,8-tetrahydronaphthalen-1-yliminomethyl)phenol |
| SMILES | CCOc1cccc(/C=N/c2cccc3c2CCCC3)c1O |
| InChI | InChI=1S/C19H21NO2/c1-2-22-18-12-6-9-15(19(18)21)13-20-17-11-5-8-14-7-3-4-10-16(14)17/h5-6,8-9,11-13,21H,2-4,7,10H2,1H3/b20-13+ |
| InChIKey | ZIBDAJYSXYKYBW-DEDYPNTBSA-N |
| XLogP | 4.42 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|