C26H21NO3 — CID 136702059
4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-2,6-diphenylphenol (PubChem CID 136702059) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-2,6-diphenylphenol.
| Compound Name | 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-2,6-diphenylphenol |
|---|---|
| PubChem CID | 136702059 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-2,6-diphenylphenol |
| SMILES | COc1cccc(/C=N/c2cc(-c3ccccc3)c(O)c(-c3ccccc3)c2)c1O |
| InChI | InChI=1S/C26H21NO3/c1-30-24-14-8-13-20(25(24)28)17-27-21-15-22(18-9-4-2-5-10-18)26(29)23(16-21)19-11-6-3-7-12-19/h2-17,28-29H,1H3/b27-17+ |
| InChIKey | RERPOKJACLCBGU-WPWMEQJKSA-N |
| XLogP | 6.19 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|