C28H24N2O4 — CID 137256616
2-[[4-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]-6-methylphenol (PubChem CID 137256616) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[4-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]-6-methylphenol.
| Compound Name | 2-[[4-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 137256616 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[4-[4-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]-6-methylphenol |
| SMILES | COc1cccc(/C=N/c2ccc(Oc3ccc(/N=C/c4cccc(C)c4O)cc3)cc2)c1O |
| InChI | InChI=1S/C28H24N2O4/c1-19-5-3-6-20(27(19)31)17-29-22-9-13-24(14-10-22)34-25-15-11-23(12-16-25)30-18-21-7-4-8-26(33-2)28(21)32/h3-18,31-32H,1-2H3/b29-17+,30-18+ |
| InChIKey | HLVCURVHHLQJNG-YAGSLNJISA-N |
| XLogP | 6.71 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|