C28H24N2O6S — CID 135424005
2-[[3-[3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]-6-methoxyphenol (PubChem CID 135424005) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[[3-[3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[[3-[3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135424005 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2-[[3-[3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2cccc(S(=O)(=O)c3cccc(/N=C/c4cccc(OC)c4O)c3)c2)c1O |
| InChI | InChI=1S/C28H24N2O6S/c1-35-25-13-3-7-19(27(25)31)17-29-21-9-5-11-23(15-21)37(33,34)24-12-6-10-22(16-24)30-18-20-8-4-14-26(36-2)28(20)32/h3-18,31-32H,1-2H3/b29-17+,30-18+ |
| InChIKey | ODTBAKJEIGKUIQ-YAGSLNJISA-N |
| XLogP | 5.45 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|