C30H36EuN2O10+3 — CID 140556770
2-[[4,5-bis[2-(2-hydroxyethoxy)ethoxy]-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]iminomethyl]-6-methoxyphenol;europium(3+) (PubChem CID 140556770) has the molecular formula C30H36EuN2O10+3 and a molecular weight of 736.59 g/mol. Its IUPAC name is 2-[[4,5-bis[2-(2-hydroxyethoxy)ethoxy]-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]iminomethyl]-6-methoxyphenol;europium(3+).
| Compound Name | 2-[[4,5-bis[2-(2-hydroxyethoxy)ethoxy]-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]iminomethyl]-6-methoxyphenol;europium(3+) |
|---|---|
| PubChem CID | 140556770 |
| Molecular Formula | C30H36EuN2O10+3 |
| Molecular Weight | 736.59 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | 2-[[4,5-bis[2-(2-hydroxyethoxy)ethoxy]-2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]phenyl]iminomethyl]-6-methoxyphenol;europium(3+) |
| SMILES | COc1cccc(/C=N/c2cc(OCCOCCO)c(OCCOCCO)cc2/N=C/c2cccc(OC)c2O)c1O.[Eu+3] |
| InChI | InChI=1S/C30H36N2O10.Eu/c1-37-25-7-3-5-21(29(25)35)19-31-23-17-27(41-15-13-39-11-9-33)28(42-16-14-40-12-10-34)18-24(23)32-20-22-6-4-8-26(38-2)30(22)36;/h3-8,17-20,33-36H,9-16H2,1-2H3;/q;+3/b31-19+,32-20+; |
| InChIKey | JFUCSWFEDJWRBH-IZXMOPRRSA-N |
| XLogP | 3.39 |
| TPSA | 161.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|