C17H12NO8S2- — CID 3366269
5-hydroxy-4-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate (PubChem CID 3366269) has the molecular formula C17H12NO8S2- and a molecular weight of 422.42 g/mol. Its IUPAC name is 5-hydroxy-4-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate.
| Compound Name | 5-hydroxy-4-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 3366269 |
| Molecular Formula | C17H12NO8S2- |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 5-hydroxy-4-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(/N=C/c2ccccc2O)c2c(O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C17H13NO8S2/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14/h1-9,19-20H,(H,21,22,23)(H,24,25,26)/p-1/b18-9+ |
| InChIKey | DUCCKQSNXPFEGT-GIJQJNRQSA-M |
| XLogP | 2.15 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|