C26H18N4O12S3 — CID 136785108
4-[[2,4-dihydroxy-5-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136785108) has the molecular formula C26H18N4O12S3 and a molecular weight of 674.65 g/mol. Its IUPAC name is 4-[[2,4-dihydroxy-5-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2,4-dihydroxy-5-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136785108 |
| Molecular Formula | C26H18N4O12S3 |
| Molecular Weight | 674.65 g/mol |
| Exact Mass | 674.01 |
| IUPAC Name | 4-[[2,4-dihydroxy-5-[(4-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(/N=N/c3cc(/N=N/c4ccc(S(=O)(=O)O)c5ccccc45)c(O)cc3O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C26H18N4O12S3/c31-22-12-23(32)20(11-19(22)28-27-18-5-6-25(45(40,41)42)17-4-2-1-3-16(17)18)29-30-21-9-14(43(34,35)36)7-13-8-15(44(37,38)39)10-24(33)26(13)21/h1-12,31-33H,(H,34,35,36)(H,37,38,39)(H,40,41,42)/b28-27+,30-29+ |
| InChIKey | NZLRODDPOMXVOY-XOXGWFOHSA-N |
| XLogP | 5.68 |
| TPSA | 273.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|