C21H16N2O9S3 — CID 136508592
7-hydroxy-8-[(4-methylsulfonylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 136508592) has the molecular formula C21H16N2O9S3 and a molecular weight of 536.57 g/mol. Its IUPAC name is 7-hydroxy-8-[(4-methylsulfonylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-hydroxy-8-[(4-methylsulfonylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 136508592 |
| Molecular Formula | C21H16N2O9S3 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 7-hydroxy-8-[(4-methylsulfonylnaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)c2ccccc12 |
| InChI | InChI=1S/C21H16N2O9S3/c1-33(25,26)18-9-7-16(14-4-2-3-5-15(14)18)22-23-21-17(24)8-6-12-10-13(34(27,28)29)11-19(20(12)21)35(30,31)32/h2-11,24H,1H3,(H,27,28,29)(H,30,31,32)/b23-22+ |
| InChIKey | FDKJEAXLXWYSFW-GHVJWSGMSA-N |
| XLogP | 4.01 |
| TPSA | 187.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|