C21H16N2O6S2 — CID 143879514
6-hydroxy-4-methylsulfonyl-5-(naphthalen-1-yldiazenyl)naphthalene-2-sulfonic acid (PubChem CID 143879514) has the molecular formula C21H16N2O6S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-hydroxy-4-methylsulfonyl-5-(naphthalen-1-yldiazenyl)naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-4-methylsulfonyl-5-(naphthalen-1-yldiazenyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143879514 |
| Molecular Formula | C21H16N2O6S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 6-hydroxy-4-methylsulfonyl-5-(naphthalen-1-yldiazenyl)naphthalene-2-sulfonic acid |
| SMILES | CS(=O)(=O)c1cc(S(=O)(=O)O)cc2ccc(O)c(/N=N/c3cccc4ccccc34)c12 |
| InChI | InChI=1S/C21H16N2O6S2/c1-30(25,26)19-12-15(31(27,28)29)11-14-9-10-18(24)21(20(14)19)23-22-17-8-4-6-13-5-2-3-7-16(13)17/h2-12,24H,1H3,(H,27,28,29)/b23-22+ |
| InChIKey | GSKPLDFBOLGSLE-GHVJWSGMSA-N |
| XLogP | 4.76 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|