C20H14N2O9S3 — CID 175326854
7-hydroxy-8-[(4-sulfinonaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 175326854) has the molecular formula C20H14N2O9S3 and a molecular weight of 522.54 g/mol. Its IUPAC name is 7-hydroxy-8-[(4-sulfinonaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-hydroxy-8-[(4-sulfinonaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 175326854 |
| Molecular Formula | C20H14N2O9S3 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 7-hydroxy-8-[(4-sulfinonaphthalen-1-yl)diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | O=S(O)c1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)c2ccccc12 |
| InChI | InChI=1S/C20H14N2O9S3/c23-16-7-5-11-9-12(33(26,27)28)10-18(34(29,30)31)19(11)20(16)22-21-15-6-8-17(32(24)25)14-4-2-1-3-13(14)15/h1-10,23H,(H,24,25)(H,26,27,28)(H,29,30,31)/b22-21+ |
| InChIKey | IPCAABVBNZZUKY-QURGRASLSA-N |
| XLogP | 4.19 |
| TPSA | 190.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|