C20H11N2O10S3-3 — CID 102424335
6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate (PubChem CID 102424335) has the molecular formula C20H11N2O10S3-3 and a molecular weight of 535.51 g/mol. Its IUPAC name is 6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | 6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 102424335 |
| Molecular Formula | C20H11N2O10S3-3 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | 6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)O)c2c(/N=N/c3ccc(S(=O)(=O)[O-])c4ccccc34)c([O-])ccc2c1 |
| InChI | InChI=1S/C20H14N2O10S3/c23-16-7-5-11-9-12(33(24,25)26)10-18(35(30,31)32)19(11)20(16)22-21-15-6-8-17(34(27,28)29)14-4-2-1-3-13(14)15/h1-10,23H,(H,24,25,26)(H,27,28,29)(H,30,31,32)/p-3/b22-21+ |
| InChIKey | JZGWEIPJUAIDHM-QURGRASLSA-K |
| XLogP | 2.54 |
| TPSA | 216.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|