C25H21N3Na2O9S3 — CID 102269106
disodium;5-[[3-[ethyl(phenyl)sulfamoyl]-4-methylphenyl]diazenyl]-6-oxido-4-sulfonaphthalene-2-sulfonate (PubChem CID 102269106) has the molecular formula C25H21N3Na2O9S3 and a molecular weight of 649.64 g/mol. Its IUPAC name is disodium;5-[[3-[ethyl(phenyl)sulfamoyl]-4-methylphenyl]diazenyl]-6-oxido-4-sulfonaphthalene-2-sulfonate.
| Compound Name | disodium;5-[[3-[ethyl(phenyl)sulfamoyl]-4-methylphenyl]diazenyl]-6-oxido-4-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 102269106 |
| Molecular Formula | C25H21N3Na2O9S3 |
| Molecular Weight | 649.64 g/mol |
| Exact Mass | 649.02 |
| IUPAC Name | disodium;5-[[3-[ethyl(phenyl)sulfamoyl]-4-methylphenyl]diazenyl]-6-oxido-4-sulfonaphthalene-2-sulfonate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(/N=N/c2c([O-])ccc3cc(S(=O)(=O)[O-])cc(S(=O)(=O)O)c23)ccc1C.[Na+].[Na+] |
| InChI | InChI=1S/C25H23N3O9S3.2Na/c1-3-28(19-7-5-4-6-8-19)38(30,31)22-14-18(11-9-16(22)2)26-27-25-21(29)12-10-17-13-20(39(32,33)34)15-23(24(17)25)40(35,36)37;;/h4-15,29H,3H2,1-2H3,(H,32,33,34)(H,35,36,37);;/q;2*+1/p-2/b27-26+;; |
| InChIKey | PAADLUNUXAUQFN-YOYNBWDYSA-L |
| XLogP | -1.99 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.64 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|