C16H11N3O9S3-2 — CID 102497656
6-oxido-5-[(4-sulfamoylphenyl)diazenyl]-4-sulfonaphthalene-2-sulfonate (PubChem CID 102497656) has the molecular formula C16H11N3O9S3-2 and a molecular weight of 485.48 g/mol. Its IUPAC name is 6-oxido-5-[(4-sulfamoylphenyl)diazenyl]-4-sulfonaphthalene-2-sulfonate.
| Compound Name | 6-oxido-5-[(4-sulfamoylphenyl)diazenyl]-4-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 102497656 |
| Molecular Formula | C16H11N3O9S3-2 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | 6-oxido-5-[(4-sulfamoylphenyl)diazenyl]-4-sulfonaphthalene-2-sulfonate |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2c([O-])ccc3cc(S(=O)(=O)[O-])cc(S(=O)(=O)O)c23)cc1 |
| InChI | InChI=1S/C16H13N3O9S3/c17-29(21,22)11-4-2-10(3-5-11)18-19-16-13(20)6-1-9-7-12(30(23,24)25)8-14(15(9)16)31(26,27)28/h1-8,20H,(H2,17,21,22)(H,23,24,25)(H,26,27,28)/p-2/b19-18+ |
| InChIKey | LCHLFANYCOFSJX-VHEBQXMUSA-L |
| XLogP | 1.13 |
| TPSA | 219.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|