C16H10N2Na2O8S2 — CID 170839401
disodium;4-hydroxy-5-oxido-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfonate (PubChem CID 170839401) has the molecular formula C16H10N2Na2O8S2 and a molecular weight of 468.38 g/mol. Its IUPAC name is disodium;4-hydroxy-5-oxido-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfonate.
| Compound Name | disodium;4-hydroxy-5-oxido-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 170839401 |
| Molecular Formula | C16H10N2Na2O8S2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | disodium;4-hydroxy-5-oxido-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)c2c([O-])c(/N=N/c3ccccc3)c(S(=O)(=O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O8S2.2Na/c19-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)18-17-10-4-2-1-3-5-10;;/h1-8,19-20H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b18-17+;; |
| InChIKey | GXEAXHYQKZAJGB-QIKYXUGXSA-L |
| XLogP | -3.81 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|