C16H9ClN2Na2O8S2 — CID 101234625
disodium;2-[(4-chlorophenyl)diazenyl]-3,6-disulfonaphthalene-1,8-diolate (PubChem CID 101234625) has the molecular formula C16H9ClN2Na2O8S2 and a molecular weight of 502.82 g/mol. Its IUPAC name is disodium;2-[(4-chlorophenyl)diazenyl]-3,6-disulfonaphthalene-1,8-diolate.
| Compound Name | disodium;2-[(4-chlorophenyl)diazenyl]-3,6-disulfonaphthalene-1,8-diolate |
|---|---|
| PubChem CID | 101234625 |
| Molecular Formula | C16H9ClN2Na2O8S2 |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 501.93 |
| IUPAC Name | disodium;2-[(4-chlorophenyl)diazenyl]-3,6-disulfonaphthalene-1,8-diolate |
| SMILES | O=S(=O)(O)c1cc([O-])c2c([O-])c(/N=N/c3ccc(Cl)cc3)c(S(=O)(=O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H11ClN2O8S2.2Na/c17-9-1-3-10(4-2-9)18-19-15-13(29(25,26)27)6-8-5-11(28(22,23)24)7-12(20)14(8)16(15)21;;/h1-7,20-21H,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b19-18+;; |
| InChIKey | PFDBTXMAFWWIGE-BUFQOAPZSA-L |
| XLogP | -3.44 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|