C32H20Cl2N4O14S6 — CID 142756628
5-chloro-3-[[4-[[4-[(8-chloro-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]phenyl]disulfanyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 142756628) has the molecular formula C32H20Cl2N4O14S6 and a molecular weight of 947.83 g/mol. Its IUPAC name is 5-chloro-3-[[4-[[4-[(8-chloro-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]phenyl]disulfanyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-chloro-3-[[4-[[4-[(8-chloro-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]phenyl]disulfanyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 142756628 |
| Molecular Formula | C32H20Cl2N4O14S6 |
| Molecular Weight | 947.83 g/mol |
| Exact Mass | 945.87 |
| IUPAC Name | 5-chloro-3-[[4-[[4-[(8-chloro-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]phenyl]disulfanyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)c2c(O)c(/N=N/c3ccc(SSc4ccc(/N=N/c5c(S(=O)(=O)O)cc6cc(S(=O)(=O)O)cc(Cl)c6c5O)cc4)cc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C32H20Cl2N4O14S6/c33-23-13-21(55(41,42)43)9-15-11-25(57(47,48)49)29(31(39)27(15)23)37-35-17-1-5-19(6-2-17)53-54-20-7-3-18(4-8-20)36-38-30-26(58(50,51)52)12-16-10-22(56(44,45)46)14-24(34)28(16)32(30)40/h1-14,39-40H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b37-35+,38-36+ |
| InChIKey | SYXIZNITBDQJIR-ATXIYDNESA-N |
| XLogP | 9.33 |
| TPSA | 307.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.83 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|