C17H13N3O9S2 — CID 136502364
4-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid (PubChem CID 136502364) has the molecular formula C17H13N3O9S2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 4-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid.
| Compound Name | 4-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136502364 |
| Molecular Formula | C17H13N3O9S2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | 4-[(8-amino-1-hydroxy-3,6-disulfonaphthalen-2-yl)diazenyl]benzoic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(C(=O)O)cc3)c(O)c12 |
| InChI | InChI=1S/C17H13N3O9S2/c18-12-7-11(30(24,25)26)5-9-6-13(31(27,28)29)15(16(21)14(9)12)20-19-10-3-1-8(2-4-10)17(22)23/h1-7,21H,18H2,(H,22,23)(H,24,25,26)(H,27,28,29)/b20-19+ |
| InChIKey | KBWNXQWZVZIVTO-FMQUCBEESA-N |
| XLogP | 2.73 |
| TPSA | 217.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|