C16H12N2NaO8S2+ — CID 135436511
sodium 4,5-dihydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 135436511) has the molecular formula C16H12N2NaO8S2+ and a molecular weight of 447.40 g/mol. Its IUPAC name is sodium 4,5-dihydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | sodium 4,5-dihydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135436511 |
| Molecular Formula | C16H12N2NaO8S2+ |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | sodium 4,5-dihydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(O)c(/N=N/c3ccccc3)c(S(=O)(=O)O)cc2c1.[Na+] |
| InChI | InChI=1S/C16H12N2O8S2.Na/c19-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)18-17-10-4-2-1-3-5-10;/h1-8,19-20H,(H,21,22,23)(H,24,25,26);/q;+1/b18-17+; |
| InChIKey | FXTXDTFGNFVUTK-ZAGWXBKKSA-N |
| XLogP | 0.16 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|