C18H17N3NaO8S2+ — CID 135421847
sodium 3-[[4-(ethylamino)phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135421847) has the molecular formula C18H17N3NaO8S2+ and a molecular weight of 490.47 g/mol. Its IUPAC name is sodium 3-[[4-(ethylamino)phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | sodium 3-[[4-(ethylamino)phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135421847 |
| Molecular Formula | C18H17N3NaO8S2+ |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | sodium 3-[[4-(ethylamino)phenyl]diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CCNc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c3c2O)cc1.[Na+] |
| InChI | InChI=1S/C18H17N3O8S2.Na/c1-2-19-11-3-5-12(6-4-11)20-21-17-15(31(27,28)29)8-10-7-13(30(24,25)26)9-14(22)16(10)18(17)23;/h3-9,19,22-23H,2H2,1H3,(H,24,25,26)(H,27,28,29);/q;+1/b21-20+; |
| InChIKey | OOUMQCCPBIDKPF-ANVLNOONSA-N |
| XLogP | 0.60 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|