C20H14N2O11S3 — CID 4147930
4,5-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 4147930) has the molecular formula C20H14N2O11S3 and a molecular weight of 554.54 g/mol. Its IUPAC name is 4,5-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4,5-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 4147930 |
| Molecular Formula | C20H14N2O11S3 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | 4,5-dihydroxy-3-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(O)c(/N=N/c3ccc(S(=O)(=O)O)c4ccccc34)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C20H14N2O11S3/c23-15-9-11(34(25,26)27)7-10-8-17(36(31,32)33)19(20(24)18(10)15)22-21-14-5-6-16(35(28,29)30)13-4-2-1-3-12(13)14/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33)/b22-21+ |
| InChIKey | XRBNWBONDUAVJJ-QURGRASLSA-N |
| XLogP | 3.56 |
| TPSA | 228.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|