C18H14N2O12S3 — CID 137175808
3-[(4-acetyl-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid (PubChem CID 137175808) has the molecular formula C18H14N2O12S3 and a molecular weight of 546.51 g/mol. Its IUPAC name is 3-[(4-acetyl-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(4-acetyl-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 137175808 |
| Molecular Formula | C18H14N2O12S3 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 545.97 |
| IUPAC Name | 3-[(4-acetyl-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CC(=O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H14N2O12S3/c1-8(21)9-2-3-12(14(5-9)34(27,28)29)19-20-17-15(35(30,31)32)6-10-4-11(33(24,25)26)7-13(22)16(10)18(17)23/h2-7,22-23H,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32)/b20-19+ |
| InChIKey | DAVZKULJBOKTKS-FMQUCBEESA-N |
| XLogP | 2.61 |
| TPSA | 245.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|