C19H14ClN7O7S2 — CID 136703984
5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136703984) has the molecular formula C19H14ClN7O7S2 and a molecular weight of 551.95 g/mol. Its IUPAC name is 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136703984 |
| Molecular Formula | C19H14ClN7O7S2 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 551.01 |
| IUPAC Name | 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | Nc1nc(Cl)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4)c(O)c23)n1 |
| InChI | InChI=1S/C19H14ClN7O7S2/c20-17-23-18(21)25-19(24-17)22-12-8-11(35(29,30)31)6-9-7-13(36(32,33)34)15(16(28)14(9)12)27-26-10-4-2-1-3-5-10/h1-8,28H,(H,29,30,31)(H,32,33,34)(H3,21,22,23,24,25)/b27-26+ |
| InChIKey | WABVWKUSOLUIDY-CYYJNZCTSA-N |
| XLogP | 3.62 |
| TPSA | 230.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|