C21H17ClN6O9S2 — CID 136694630
5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxyphenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136694630) has the molecular formula C21H17ClN6O9S2 and a molecular weight of 596.99 g/mol. Its IUPAC name is 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxyphenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxyphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136694630 |
| Molecular Formula | C21H17ClN6O9S2 |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxyphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(Nc4nc(Cl)nc(OC)n4)c3c2O)cc1 |
| InChI | InChI=1S/C21H17ClN6O9S2/c1-36-12-5-3-11(4-6-12)27-28-17-15(39(33,34)35)8-10-7-13(38(30,31)32)9-14(16(10)18(17)29)23-20-24-19(22)25-21(26-20)37-2/h3-9,29H,1-2H3,(H,30,31,32)(H,33,34,35)(H,23,24,25,26)/b28-27+ |
| InChIKey | HAIBYEBTGHIAPH-BYYHNAKLSA-N |
| XLogP | 4.05 |
| TPSA | 222.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|