C22H19ClN6O11S3 — CID 136694633
5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136694633) has the molecular formula C22H19ClN6O11S3 and a molecular weight of 675.08 g/mol. Its IUPAC name is 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136694633 |
| Molecular Formula | C22H19ClN6O11S3 |
| Molecular Weight | 675.08 g/mol |
| Exact Mass | 674.00 |
| IUPAC Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1nc(Cl)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(=O)(=O)CCO)cc4)c(O)c23)n1 |
| InChI | InChI=1S/C22H19ClN6O11S3/c1-40-22-26-20(23)25-21(27-22)24-15-10-14(42(34,35)36)8-11-9-16(43(37,38)39)18(19(31)17(11)15)29-28-12-2-4-13(5-3-12)41(32,33)7-6-30/h2-5,8-10,30-31H,6-7H2,1H3,(H,34,35,36)(H,37,38,39)(H,24,25,26,27)/b29-28+ |
| InChIKey | CJULITROHSIAAC-ZQHSETAFSA-N |
| XLogP | 2.81 |
| TPSA | 267.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|