C28H24ClN7NaO13S4 — CID 170842432
CID 170842432 (PubChem CID 170842432) has the molecular formula C28H24ClN7NaO13S4 and a molecular weight of 853.25 g/mol.
| Compound Name | CID 170842432 |
|---|---|
| PubChem CID | 170842432 |
| Molecular Formula | C28H24ClN7NaO13S4 |
| Molecular Weight | 853.25 g/mol |
| Exact Mass | 851.99 |
| IUPAC Name | — |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(Nc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5cc(C)c(C)cc5S(=O)(=O)O)c(O)c34)n2)c(S(=O)(=O)O)c1.[Na] |
| InChI | InChI=1S/C28H24ClN7O13S4.Na/c1-12-4-5-17(20(6-12)51(41,42)43)30-27-32-26(29)33-28(34-27)31-19-11-16(50(38,39)40)9-15-10-22(53(47,48)49)24(25(37)23(15)19)36-35-18-7-13(2)14(3)8-21(18)52(44,45)46;/h4-11,37H,1-3H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)(H2,30,31,32,33,34);/b36-35+; |
| InChIKey | KXRRPYNLLNCQHW-KPYQYLATSA-N |
| XLogP | 4.82 |
| TPSA | 325.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|