C21H16Cl2N4O10S3 — CID 19966396
5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-3-(4,5-dimethyl-2-sulfophenyl)-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 19966396) has the molecular formula C21H16Cl2N4O10S3 and a molecular weight of 651.48 g/mol. Its IUPAC name is 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-3-(4,5-dimethyl-2-sulfophenyl)-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-3-(4,5-dimethyl-2-sulfophenyl)-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 19966396 |
| Molecular Formula | C21H16Cl2N4O10S3 |
| Molecular Weight | 651.48 g/mol |
| Exact Mass | 649.94 |
| IUPAC Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-3-(4,5-dimethyl-2-sulfophenyl)-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(-c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(Nc4nc(Cl)nc(Cl)n4)c3c2O)c(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C21H16Cl2N4O10S3/c1-8-3-12(14(4-9(8)2)39(32,33)34)17-15(40(35,36)37)6-10-5-11(38(29,30)31)7-13(16(10)18(17)28)24-21-26-19(22)25-20(23)27-21/h3-7,28H,1-2H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)(H,24,25,26,27) |
| InChIKey | FTFQLCQEZXNUGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 234.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|