C13H8Cl2N4O7S2 — CID 11048924
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 11048924) has the molecular formula C13H8Cl2N4O7S2 and a molecular weight of 467.27 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 11048924 |
| Molecular Formula | C13H8Cl2N4O7S2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 465.92 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(Nc3nc(Cl)nc(Cl)n3)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C13H8Cl2N4O7S2/c14-11-17-12(15)19-13(18-11)16-8-3-6(27(21,22)23)1-5-2-7(28(24,25)26)4-9(20)10(5)8/h1-4,20H,(H,21,22,23)(H,24,25,26)(H,16,17,18,19) |
| InChIKey | IUZQZWGADVNJMI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|