C14H10Cl2N4O7S2 — CID 59079119
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)naphthalene-2-sulfonic acid (PubChem CID 59079119) has the molecular formula C14H10Cl2N4O7S2 and a molecular weight of 481.30 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)naphthalene-2-sulfonic acid.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 59079119 |
| Molecular Formula | C14H10Cl2N4O7S2 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)naphthalene-2-sulfonic acid |
| SMILES | CS1(c2cc(O)c3c(Nc4nc(Cl)nc(Cl)n4)cc(S(=O)(=O)O)cc3c2)OOO1 |
| InChI | InChI=1S/C14H10Cl2N4O7S2/c1-28(26-25-27-28)7-2-6-3-8(29(22,23)24)4-9(11(6)10(21)5-7)17-14-19-12(15)18-13(16)20-14/h2-5,21H,1H3,(H,22,23,24)(H,17,18,19,20) |
| InChIKey | JFEXTCAHFBHCRB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|