C20H13Cl2N6O7S2- — CID 135787074
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)-6-phenyldiazenylnaphthalene-2-sulfonate (PubChem CID 135787074) has the molecular formula C20H13Cl2N6O7S2- and a molecular weight of 584.40 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)-6-phenyldiazenylnaphthalene-2-sulfonate.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)-6-phenyldiazenylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135787074 |
| Molecular Formula | C20H13Cl2N6O7S2- |
| Molecular Weight | 584.40 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-7-(4-methyltrioxathietan-4-yl)-6-phenyldiazenylnaphthalene-2-sulfonate |
| SMILES | CS1(c2cc3cc(S(=O)(=O)[O-])cc(Nc4nc(Cl)nc(Cl)n4)c3c(O)c2/N=N/c2ccccc2)OOO1 |
| InChI | InChI=1S/C20H14Cl2N6O7S2/c1-36(34-33-35-36)14-8-10-7-12(37(30,31)32)9-13(23-20-25-18(21)24-19(22)26-20)15(10)17(29)16(14)28-27-11-5-3-2-4-6-11/h2-9,29H,1H3,(H,30,31,32)(H,23,24,25,26)/p-1/b28-27+ |
| InChIKey | IFAJESOQOYBXCO-BYYHNAKLSA-M |
| XLogP | 5.62 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|