C19H11Cl2N6O6S2- — CID 140585723
4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfinate (PubChem CID 140585723) has the molecular formula C19H11Cl2N6O6S2- and a molecular weight of 554.37 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfinate.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfinate |
|---|---|
| PubChem CID | 140585723 |
| Molecular Formula | C19H11Cl2N6O6S2- |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-hydroxy-6-phenyldiazenyl-7-sulfonaphthalene-2-sulfinate |
| SMILES | O=S([O-])c1cc(Nc2nc(Cl)nc(Cl)n2)c2c(O)c(/N=N/c3ccccc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C19H12Cl2N6O6S2/c20-17-23-18(21)25-19(24-17)22-12-8-11(34(29)30)6-9-7-13(35(31,32)33)15(16(28)14(9)12)27-26-10-4-2-1-3-5-10/h1-8,28H,(H,29,30)(H,31,32,33)(H,22,23,24,25)/p-1/b27-26+ |
| InChIKey | ZZRXUUDJMQDZAD-CYYJNZCTSA-M |
| XLogP | 4.68 |
| TPSA | 190.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|