C21H17ClN6O12S4 — CID 136630009
5-[(4-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-sulfooxyethylsulfinyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136630009) has the molecular formula C21H17ClN6O12S4 and a molecular weight of 709.12 g/mol. Its IUPAC name is 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-sulfooxyethylsulfinyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-sulfooxyethylsulfinyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136630009 |
| Molecular Formula | C21H17ClN6O12S4 |
| Molecular Weight | 709.12 g/mol |
| Exact Mass | 707.95 |
| IUPAC Name | 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[[4-(2-sulfooxyethylsulfinyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(CCOS(=O)(=O)O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(Nc4ncnc(Cl)n4)c3c2O)cc1 |
| InChI | InChI=1S/C21H17ClN6O12S4/c22-20-23-10-24-21(26-20)25-15-9-14(42(31,32)33)7-11-8-16(43(34,35)36)18(19(29)17(11)15)28-27-12-1-3-13(4-2-12)41(30)6-5-40-44(37,38)39/h1-4,7-10,29H,5-6H2,(H,31,32,33)(H,34,35,36)(H,37,38,39)(H,23,24,25,26)/b28-27+ |
| InChIKey | DOJJEGNOQKQREX-BYYHNAKLSA-N |
| XLogP | 2.96 |
| TPSA | 285.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|