C26H20ClN7O7S2 — CID 137253692
4-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-6-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137253692) has the molecular formula C26H20ClN7O7S2 and a molecular weight of 642.08 g/mol. Its IUPAC name is 4-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-6-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-6-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137253692 |
| Molecular Formula | C26H20ClN7O7S2 |
| Molecular Weight | 642.08 g/mol |
| Exact Mass | 641.06 |
| IUPAC Name | 4-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxy-6-[(4-methylphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc3cc(S(=O)(=O)O)cc(Nc4nc(Cl)nc(Nc5cccc(S(=O)(=O)O)c5)n4)c3c2O)cc1 |
| InChI | InChI=1S/C26H20ClN7O7S2/c1-14-5-8-16(9-6-14)33-34-20-10-7-15-11-19(43(39,40)41)13-21(22(15)23(20)35)29-26-31-24(27)30-25(32-26)28-17-3-2-4-18(12-17)42(36,37)38/h2-13,35H,1H3,(H,36,37,38)(H,39,40,41)(H2,28,29,30,31,32)/b34-33+ |
| InChIKey | HFZWHFIEGJUUMS-JEIPZWNWSA-N |
| XLogP | 6.09 |
| TPSA | 216.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.08 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|