C25H17Cl2N7O14S4 — CID 170840308
3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-1,8-disulfonic acid (PubChem CID 170840308) has the molecular formula C25H17Cl2N7O14S4 and a molecular weight of 838.62 g/mol. Its IUPAC name is 3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-1,8-disulfonic acid.
| Compound Name | 3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-1,8-disulfonic acid |
|---|---|
| PubChem CID | 170840308 |
| Molecular Formula | C25H17Cl2N7O14S4 |
| Molecular Weight | 838.62 g/mol |
| Exact Mass | 836.91 |
| IUPAC Name | 3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-5-[[4-chloro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-1,8-disulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)O)c4c(S(=O)(=O)O)cc(/N=N/c5cc(S(=O)(=O)O)cc(Cl)c5O)c(O)c34)n2)c1 |
| InChI | InChI=1S/C25H17Cl2N7O14S4/c26-13-7-12(50(40,41)42)8-15(21(13)35)33-34-16-9-18(52(46,47)48)20-17(51(43,44)45)5-4-14(19(20)22(16)36)29-25-31-23(27)30-24(32-25)28-10-2-1-3-11(6-10)49(37,38)39/h1-9,35-36H,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H2,28,29,30,31,32)/b34-33+ |
| InChIKey | UVHNWHYRABQOEP-JEIPZWNWSA-N |
| XLogP | 4.63 |
| TPSA | 345.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|