C32H29ClN8O10S3 — CID 136651150
2-[[8-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-1-hydroxy-6-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid;3-(methylaminomethyl)aniline (PubChem CID 136651150) has the molecular formula C32H29ClN8O10S3 and a molecular weight of 817.28 g/mol. Its IUPAC name is 2-[[8-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-1-hydroxy-6-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid;3-(methylaminomethyl)aniline.
| Compound Name | 2-[[8-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-1-hydroxy-6-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid;3-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 136651150 |
| Molecular Formula | C32H29ClN8O10S3 |
| Molecular Weight | 817.28 g/mol |
| Exact Mass | 816.09 |
| IUPAC Name | 2-[[8-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-1-hydroxy-6-sulfonaphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid;3-(methylaminomethyl)aniline |
| SMILES | CNCc1cccc(N)c1.Cc1nc(Cl)nc(Nc2cc(S(=O)(=O)O)cc3ccc(/N=N/c4ccc5c(S(=O)(=O)O)cccc5c4S(=O)(=O)O)c(O)c23)n1 |
| InChI | InChI=1S/C24H17ClN6O10S3.C8H12N2/c1-11-26-23(25)29-24(27-11)28-18-10-13(42(33,34)35)9-12-5-7-16(21(32)20(12)18)30-31-17-8-6-14-15(22(17)44(39,40)41)3-2-4-19(14)43(36,37)38;1-10-6-7-3-2-4-8(9)5-7/h2-10,32H,1H3,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,26,27,28,29);2-5,10H,6,9H2,1H3/b31-30+; |
| InChIKey | ZUAHEOPKNOKBPG-FJISBNMDSA-N |
| XLogP | 5.73 |
| TPSA | 296.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.28 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|