C14H11ClN4O6S2 — CID 58879255
2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1,5-disulfonic acid (PubChem CID 58879255) has the molecular formula C14H11ClN4O6S2 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 58879255 |
| Molecular Formula | C14H11ClN4O6S2 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1nc(Cl)nc(Nc2ccc3c(S(=O)(=O)O)cccc3c2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C14H11ClN4O6S2/c1-7-16-13(15)19-14(17-7)18-10-6-5-8-9(12(10)27(23,24)25)3-2-4-11(8)26(20,21)22/h2-6H,1H3,(H,20,21,22)(H,23,24,25)(H,16,17,18,19) |
| InChIKey | GSZJIXIOQHPMNQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|