C11H12ClN5O3S — CID 23532452
2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(methylamino)benzenesulfonic acid (PubChem CID 23532452) has the molecular formula C11H12ClN5O3S and a molecular weight of 329.77 g/mol. Its IUPAC name is 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(methylamino)benzenesulfonic acid.
| Compound Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(methylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 23532452 |
| Molecular Formula | C11H12ClN5O3S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(methylamino)benzenesulfonic acid |
| SMILES | CNc1ccc(Nc2nc(C)nc(Cl)n2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H12ClN5O3S/c1-6-14-10(12)17-11(15-6)16-8-4-3-7(13-2)5-9(8)21(18,19)20/h3-5,13H,1-2H3,(H,18,19,20)(H,14,15,16,17) |
| InChIKey | XROJORBOXRRFGR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|