C25H19ClN6O5S — CID 54258240
4-[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]-2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 54258240) has the molecular formula C25H19ClN6O5S and a molecular weight of 550.98 g/mol. Its IUPAC name is 4-[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]-2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 4-[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]-2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 54258240 |
| Molecular Formula | C25H19ClN6O5S |
| Molecular Weight | 550.98 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 4-[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]-2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | Cc1nc(Cl)nc(Nc2cc(Nc3cc(C)c(N)c4c3C(=O)c3ccccc3C4=O)ccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C25H19ClN6O5S/c1-11-9-17(19-20(21(11)27)23(34)15-6-4-3-5-14(15)22(19)33)30-13-7-8-18(38(35,36)37)16(10-13)31-25-29-12(2)28-24(26)32-25/h3-10,30H,27H2,1-2H3,(H,35,36,37)(H,28,29,31,32) |
| InChIKey | CCVBZHXUCAMQJI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 177.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|