C30H21ClN6O11S3 — CID 159193181
1-amino-4-[4-[[4-chloro-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 159193181) has the molecular formula C30H21ClN6O11S3 and a molecular weight of 773.18 g/mol. Its IUPAC name is 1-amino-4-[4-[[4-chloro-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[[4-chloro-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 159193181 |
| Molecular Formula | C30H21ClN6O11S3 |
| Molecular Weight | 773.18 g/mol |
| Exact Mass | 772.01 |
| IUPAC Name | 1-amino-4-[4-[[4-chloro-6-[(4-sulfophenyl)methyl]-1,3,5-triazin-2-yl]amino]-2-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(Nc3nc(Cl)nc(Cc4ccc(S(=O)(=O)O)cc4)n3)cc2S(=O)(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H21ClN6O11S3/c31-29-35-23(11-14-5-8-16(9-6-14)49(40,41)42)36-30(37-29)33-15-7-10-19(21(12-15)50(43,44)45)34-20-13-22(51(46,47)48)26(32)25-24(20)27(38)17-3-1-2-4-18(17)28(25)39/h1-10,12-13,34H,11,32H2,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,33,35,36,37) |
| InChIKey | KOIOZMSABRIOOS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 286.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|